CAS 82413-63-6

4-(morpholin-4-ylmethyl)benzaldehyde

Description:

4-(Morpholin-4-ylmethyl)benzaldehyde is an organic compound characterized by the presence of a benzaldehyde functional group attached to a morpholine moiety. This compound features a benzene ring substituted with a morpholin-4-ylmethyl group, which contributes to its unique chemical properties. The morpholine ring, a six-membered heterocycle containing both oxygen and nitrogen, enhances the compound's solubility in polar solvents and may influence its reactivity and biological activity. Typically, compounds like this can exhibit various properties such as moderate to high melting points and boiling points, depending on their molecular interactions. They may also show potential as intermediates in organic synthesis or as building blocks in pharmaceuticals due to the presence of both aromatic and heterocyclic structures. Additionally, the aldehyde functional group can participate in various chemical reactions, including nucleophilic additions and condensation reactions, making it versatile in synthetic chemistry. Overall, 4-(morpholin-4-ylmethyl)benzaldehyde is a compound of interest in both academic and industrial chemistry contexts.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1/C12H15NO2/c14-10-12-3-1-11(2-4-12)9-13-5-7-15-8-6-13/h1-4,10H,5-9H2

SMILES: c1cc(ccc1CN1CCOCC1)C=O

Synonyms:

• 4-(Morpholinomethyl)Benzaldehyde
• Benzaldehyde, 4-(4-Morpholinylmethyl)-
• 4-(Morpholin-4-ylmethyl)benzaldehyde

Benzaldehyde,4-(4-morpholinylmethyl)-

CAS: 82413-63-6

Formula: C₁₂H₁₅NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 205.2530

Ref: IN-DA004WZA

4-(Morpholinomethyl)benzaldehyde

CAS: 82413-63-6

4-(Morpholinomethyl)benzaldehyde

Purity: 98%

Ref: 54-OR1042339

4-(4-Carboxaldehydebenzyl)morpholine

CAS: 82413-63-6

Formula: C₁₂H₁₅NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.257

Ref: 10-F394538