CAS 82414-03-7
:1-methyl-2-nitro-4-nitrosobenzene
Description:
1-Methyl-2-nitro-4-nitrosobenzene, with the CAS number 82414-03-7, is an organic compound characterized by its aromatic structure, which includes a methyl group, a nitro group, and a nitroso group attached to a benzene ring. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. The presence of both nitro and nitroso functional groups contributes to its reactivity, making it a subject of interest in studies related to electrophilic aromatic substitution and other chemical transformations. Additionally, due to the presence of nitro and nitroso groups, this compound may exhibit significant biological activity, which necessitates careful handling and consideration of safety protocols. Its stability and solubility characteristics can vary depending on the solvent and environmental conditions, influencing its behavior in chemical reactions and applications.
Formula:C7H6N2O3
InChI:InChI=1/C7H6N2O3/c1-5-2-3-6(8-10)4-7(5)9(11)12/h2-4H,1H3
SMILES:Cc1ccc(cc1N(=O)=O)N=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.