CAS 82414-60-6

1,1,3,3-tetradeuterio-2,2-bis[dideuterio(hydroxy)methyl]propane-1,3-diol

Description:

1,1,3,3-Tetradeuterio-2,2-bis[dideuterio(hydroxy)methyl]propane-1,3-diol, with CAS number 82414-60-6, is a deuterated compound that serves as a valuable tool in various fields, particularly in nuclear magnetic resonance (NMR) spectroscopy and tracer studies. The presence of deuterium, a stable isotope of hydrogen, enhances the sensitivity and resolution of NMR experiments, making it useful for studying molecular structures and dynamics. This compound features multiple hydroxymethyl groups, which contribute to its hydrophilicity and potential solubility in polar solvents. Its structural characteristics suggest that it may participate in hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, the deuterated nature of this compound can affect its reactivity and interaction with other substances, making it a subject of interest in synthetic chemistry and biochemical applications. Overall, its unique isotopic composition and functional groups position it as a significant compound in research and analytical chemistry.

Formula: C₅H₄D₈O₄

InChI: InChI=1/C5H12O4/c6-1-5(2-7,3-8)4-9/h6-9H,1-4H2/i1D2,2D2,3D2,4D2

SMILES: C(C(C(O)([2H])[2H])(C(O)([2H])[2H])C(O)([2H])[2H])(O)([2H])[2H]

Pentaerythritol-d8

Controlled Product

CAS: 82414-60-6

Applications Used in cosmetic compositions.
References Chasin, M., et al.: Biopharm. Manufacturing, 1, 33 (1988), Cohen, S., et al.: Pharm. Res., 8, 713 (1991), Anderson, J., et al.: Eur. J. Pharm. Biopharm., 40, 1 (1994), Park, H., et al.: Pharm. Res., 13, 1770 (1996),

Formula: C₅₂H₈H₄O₄

Color and Shape: Neat

Molecular weight: 144.20

Ref: TR-P269952