
CAS 82415-85-8
:2-Chloro-3(2H)-benzofuranone
Description:
2-Chloro-3(2H)-benzofuranone, with the CAS number 82415-85-8, is an organic compound characterized by its unique structure that combines a benzofuran moiety with a chloro substituent. This compound typically appears as a white to off-white solid and is known for its aromatic properties due to the presence of the benzofuran ring. It has a moderate molecular weight and exhibits a range of chemical reactivity, particularly in electrophilic substitution reactions due to the electron-withdrawing effect of the chlorine atom. The compound is often studied for its potential applications in organic synthesis and medicinal chemistry, where it may serve as an intermediate in the synthesis of more complex molecules. Additionally, its properties may include solubility in organic solvents and stability under standard laboratory conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H5ClO2
InChI:InChI=1S/C8H5ClO2/c9-8-7(10)5-3-1-2-4-6(5)11-8/h1-4,8H
InChI key:InChIKey=BPVFPLAMYJSECH-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC1Cl)=CC=CC2
Synonyms:- 3(2H)-Benzofuranone, 2-chloro-
- 2-Chloro-3(2H)-benzofuranone
- 2-Chloro-2,3-dihydro-1-benzofuran-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.