CAS 82419-26-9

2,3-Difluoro-6-nitrophenol

Description:

2,3-Difluoro-6-nitrophenol is an organic compound characterized by the presence of two fluorine atoms and a nitro group attached to a phenolic ring. Its molecular structure features a hydroxyl group (-OH) that contributes to its acidic properties, making it a weak acid. The fluorine substituents enhance the compound's reactivity and influence its electronic properties, potentially affecting its solubility and stability in various solvents. The nitro group (-NO2) is a strong electron-withdrawing group, which can further modify the compound's reactivity and make it useful in various chemical reactions, including nucleophilic substitutions. This compound is typically used in research and industrial applications, particularly in the synthesis of more complex organic molecules. Its CAS number, 82419-26-9, is a unique identifier that facilitates its identification in chemical databases. Safety data sheets should be consulted for handling and storage guidelines, as compounds with nitro and fluorine groups can pose specific health and environmental risks.

Formula: C₆H₂F₂NO₃

InChI: InChI=1/C6H3F2NO3/c7-3-1-2-4(9(11)12)6(10)5(3)8/h1-2,10H/p-1

SMILES: c1cc(c(c(c1F)F)[O-])N(=O)=O

Synonyms:

• Benzamide, 4-fluoro-
• 2,3-Difluoro-6-Nitrophenolate

2,3-Difluoro-6-nitrophenol

CAS: 82419-26-9

Formula: C₆H₃F₂NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.0897

Ref: IN-DA004WZ7

2,3-Difluoro-6-nitrophenol

CAS: 82419-26-9

2,3-Difluoro-6-nitrophenol

Formula: C₆H₃F₂NO₃

Purity: 97%

Color and Shape: off-white to yellow powder

Molecular weight: 175.09g/mol

Ref: 54-PC0285

2,3-Difluoro-6-nitrophenol

CAS: 82419-26-9

Formula: C₆H₃F₂NO₃

Molecular weight: 175.09

Ref: 7W-GK4267

2,3-Difluoro-6-nitrophenol

CAS: 82419-26-9

Formula: C₆H₃F₂NO₃

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow to Green powder to crystal

Molecular weight: 175.09

Ref: 3B-D2705

2,3-Difluoro-6-nitrophenol

CAS: 82419-26-9

2,3-Difluoro-6-nitrophenol is a fluorinated phenolic compound that is used in biochemical research as a competitive inhibitor of bacterial growth. It is synthesized by the reaction of 2,3-difluorophenol with nitric acid. The chemical structure can be determined through infrared, NMR, and mass spectrometry techniques. 2,3-Difluoro-6-nitrophenol has been shown to inhibit bacterial growth by binding to the enzyme cytochrome c oxidase. This inhibition prevents electron transport from occurring, resulting in an accumulation of reactive oxygen species and cell death.

Formula: C₆H₃F₂NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 175.09 g/mol

Ref: 3D-FD69832

2,3-Difluoro-6-nitrophenol

CAS: 82419-26-9

Formula: C₆H₃F₂NO₃

Purity: 98%

Color and Shape: Solid, Crystalline

Molecular weight: 175.091

Ref: 10-F008167