CAS 82419-26-9
:2,3-Difluoro-6-nitrophenol
Description:
2,3-Difluoro-6-nitrophenol is an organic compound characterized by the presence of two fluorine atoms and a nitro group attached to a phenolic ring. Its molecular structure features a hydroxyl group (-OH) that contributes to its acidic properties, making it a weak acid. The fluorine substituents enhance the compound's reactivity and influence its electronic properties, potentially affecting its solubility and stability in various solvents. The nitro group (-NO2) is a strong electron-withdrawing group, which can further modify the compound's reactivity and make it useful in various chemical reactions, including nucleophilic substitutions. This compound is typically used in research and industrial applications, particularly in the synthesis of more complex organic molecules. Its CAS number, 82419-26-9, is a unique identifier that facilitates its identification in chemical databases. Safety data sheets should be consulted for handling and storage guidelines, as compounds with nitro and fluorine groups can pose specific health and environmental risks.
Formula:C6H2F2NO3
InChI:InChI=1/C6H3F2NO3/c7-3-1-2-4(9(11)12)6(10)5(3)8/h1-2,10H/p-1
SMILES:c1cc(c(c(c1F)F)[O-])N(=O)=O
Synonyms:- Benzamide, 4-fluoro-
- 2,3-Difluoro-6-Nitrophenolate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3-Difluoro-6-nitrophenol
CAS:Formula:C6H3F2NO3Purity:98%Color and Shape:SolidMolecular weight:175.08972,3-Difluoro-6-nitrophenol
CAS:2,3-Difluoro-6-nitrophenolFormula:C6H3F2NO3Purity:97%Color and Shape: off-white to yellow powderMolecular weight:175.09g/mol2,3-Difluoro-6-nitrophenol
CAS:Formula:C6H3F2NO3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:175.092,3-Difluoro-6-nitrophenol
CAS:<p>2,3-Difluoro-6-nitrophenol is a fluorinated phenolic compound that is used in biochemical research as a competitive inhibitor of bacterial growth. It is synthesized by the reaction of 2,3-difluorophenol with nitric acid. The chemical structure can be determined through infrared, NMR, and mass spectrometry techniques. 2,3-Difluoro-6-nitrophenol has been shown to inhibit bacterial growth by binding to the enzyme cytochrome c oxidase. This inhibition prevents electron transport from occurring, resulting in an accumulation of reactive oxygen species and cell death.</p>Formula:C6H3F2NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:175.09 g/mol2,3-Difluoro-6-nitrophenol
CAS:Formula:C6H3F2NO3Purity:98%Color and Shape:Solid, CrystallineMolecular weight:175.091





