![9-fluoro-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carbox…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F386005-9-fluoro-10-4-methylpiperazin-1-yl-7-oxo-23-dihydro-7h-14-oxazino-234-ij-quinoline-6-carboxylic-acid.webp&w=3840&q=75)
CAS 82419-46-3
:9-fluoro-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid
Description:
9-Fluoro-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid, with CAS number 82419-46-3, is a synthetic compound that belongs to the class of quinolone antibiotics. This substance exhibits a complex molecular structure characterized by a quinoline core fused with an oxazino ring, which contributes to its biological activity. The presence of a fluoro group enhances its antibacterial potency and stability, while the 4-methylpiperazine moiety may influence its pharmacokinetic properties, such as solubility and membrane permeability. The carboxylic acid functional group is crucial for its interaction with bacterial enzymes, facilitating its mechanism of action. This compound is primarily studied for its potential therapeutic applications in treating bacterial infections, particularly those caused by resistant strains. Its efficacy, safety profile, and specific interactions with biological targets are subjects of ongoing research in medicinal chemistry and pharmacology.
Formula:C17H18FN3O4
InChI:InChI=1/C17H18FN3O4/c1-19-2-4-20(5-3-19)14-12(18)8-10-13-16(14)25-7-6-21(13)9-11(15(10)22)17(23)24/h8-9H,2-7H2,1H3,(H,23,24)
SMILES:CN1CCN(CC1)c1c(cc2c3c1OCCn3cc(c2=O)C(=O)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
