CAS 82420-34-6

4-bromo-1-(bromomethyl)-2-nitrobenzene

Description:

4-Bromo-1-(bromomethyl)-2-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group and two bromine substituents. The presence of the nitro group (-NO2) indicates that it is a strong electron-withdrawing group, which can influence the reactivity and properties of the compound. The bromomethyl group (-CH2Br) adds to its reactivity, making it a potential intermediate in various organic synthesis reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties are influenced by the electron-withdrawing nature of the nitro group and the halogen substituents, which can affect its electrophilic and nucleophilic reactivity. Additionally, due to the presence of bromine, it may exhibit certain halogen-related characteristics, such as increased density and potential for halogen bonding. Safety precautions should be taken when handling this compound, as it may be toxic or harmful, and proper storage conditions should be observed to maintain its stability.

Formula: C₇H₅Br₂NO₂

InChI: InChI=1/C7H5Br2NO2/c8-4-5-1-2-6(9)3-7(5)10(11)12/h1-3H,4H2

SMILES: c1cc(cc(c1CBr)N(=O)=O)Br

Synonyms:

• 4-Bromo-2-Nitrobenzyl Bromide

4-Bromo-2-nitrobenzyl bromide

CAS: 82420-34-6

4-Bromo-2-nitrobenzyl bromide

Formula: C₇H₅Br₂NO₂

Purity: 98%

Color and Shape: light yellow solid

Molecular weight: 294.93g/mol

Ref: 54-OR400618

4-Bromo-1-(bromomethyl)-2-nitrobenzene

CAS: 82420-34-6

Formula: C₇H₅Br₂NO₂

Purity: 95%

Color and Shape: Solid, No data available.

Molecular weight: 294.93

Ref: 10-F222879

4-Bromo-2-nitrobenzyl bromide

CAS: 82420-34-6

Versatile small molecule scaffold

Formula: C₇H₅Br₂NO₂

Purity: Min. 95%

Molecular weight: 294.93 g/mol

Ref: 3D-HDA42034