CymitQuimica logo

CAS 82422-46-6

:

2-[(trifluoroacetyl)amino]benzenesulfonyl fluoride

Description:
2-[(Trifluoroacetyl)amino]benzenesulfonyl fluoride, with the CAS number 82422-46-6, is a chemical compound characterized by its sulfonyl fluoride functional group and the presence of a trifluoroacetylamino moiety. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the sulfonyl fluoride group, which can participate in nucleophilic substitution reactions. The trifluoroacetyl group enhances its electrophilic character, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and agrochemicals. The presence of fluorine atoms contributes to its stability and lipophilicity, which can influence its biological activity and solubility in organic solvents. Additionally, this compound may exhibit specific toxicity and environmental persistence, necessitating careful handling and disposal in laboratory settings. Overall, 2-[(trifluoroacetyl)amino]benzenesulfonyl fluoride is a versatile reagent in organic synthesis, particularly in the development of pharmaceuticals and other fine chemicals.
Formula:C8H5F4NO3S
InChI:InChI=1/C8H5F4NO3S/c9-8(10,11)7(14)13-5-3-1-2-4-6(5)17(12,15)16/h1-4H,(H,13,14)
SMILES:c1ccc(c(c1)N=C(C(F)(F)F)O)S(=O)(=O)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.