CAS 82424-58-6
:Methyl 4-amino-3-phenyl-5-isothiazolecarboxylate
Description:
Methyl 4-amino-3-phenyl-5-isothiazolecarboxylate is an organic compound characterized by its isothiazole ring, which contributes to its unique chemical properties. The presence of an amino group and a carboxylate ester enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound typically exhibits moderate solubility in polar solvents due to the presence of both hydrophilic and hydrophobic regions in its structure. Its phenyl group provides aromatic characteristics, which can influence its electronic properties and stability. Methyl 4-amino-3-phenyl-5-isothiazolecarboxylate may also exhibit biological activity, making it of interest in pharmaceutical research. The compound's molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. Overall, its unique combination of functional groups and structural features makes it a versatile compound in both synthetic and medicinal chemistry.
Formula:C11H10N2O2S
InChI:InChI=1S/C11H10N2O2S/c1-15-11(14)10-8(12)9(13-16-10)7-5-3-2-4-6-7/h2-6H,12H2,1H3
InChI key:InChIKey=BCLABDHRUQOVHX-UHFFFAOYSA-N
SMILES:NC=1C(=NSC1C(OC)=O)C2=CC=CC=C2
Synonyms:- Methyl 4-amino-3-phenyl-5-isothiazolecarboxylate
- 5-Isothiazolecarboxylic acid, 4-amino-3-phenyl-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 4-Amino-3-phenylisothiazole-5-carboxylate
CAS:Controlled ProductFormula:C11H10N2O2SColor and Shape:NeatMolecular weight:234.274Methyl 4-amino-3-phenylisothiazole-5-carboxylate
CAS:Methyl 4-amino-3-phenylisothiazole-5-carboxylate (MPI) is a molecule that has been synthesized for experimental purposes. MPI interacts with polymorphs of other molecules, such as the crystalline form of caffeine. Its interaction energies are dependent on the type and number of solvents used and the crystallographic orientation. The structure of MPI has been determined using a centrosymmetric crystal packing model, which is based on pairwise interactions. MPI is volatile, but it can be stored at a temperature below −20 °C. It can be stored in an orientations with different molecular energies.Formula:C11H10N2O2SPurity:Min. 95%Molecular weight:234.27 g/mol


