CAS 82424-75-7

4-Amino-3-phenyl-5-isothiazolecarboxylic acid

Description:

4-Amino-3-phenyl-5-isothiazolecarboxylic acid is a heterocyclic compound characterized by the presence of an isothiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a biologically active molecule. The phenyl group attached to the isothiazole structure enhances its aromatic characteristics and may influence its solubility and reactivity. The presence of both amino and carboxylic acid functional groups suggests that this compound can participate in various chemical reactions, including amide formation and acid-base interactions. It may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Additionally, the compound's unique structure may allow for specific interactions with biological targets, which could be explored in drug development. Overall, 4-Amino-3-phenyl-5-isothiazolecarboxylic acid represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₁₀H₈N₂O₂S

InChI: InChI=1S/C10H8N2O2S/c11-7-8(6-4-2-1-3-5-6)12-15-9(7)10(13)14/h1-5H,11H2,(H,13,14)

InChI key: InChIKey=RFVQCWQMQWFMPC-UHFFFAOYSA-N

SMILES: NC=1C(=NSC1C(O)=O)C2=CC=CC=C2

Synonyms:

• 5-Isothiazolecarboxylic acid, 4-amino-3-phenyl-
• 3-Phenyl-4-aminoisothiazole-5-carboxylic acid
• 4-Amino-3-phenyl-5-isothiazolecarboxylic acid

4-Amino-3-phenyl-1,2-thiazole-5-carboxylic acid

CAS: 82424-75-7

Versatile small molecule scaffold

Formula: C₁₀H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 220.25 g/mol

Ref: 3D-HDA42475