
CAS 824390-17-2
:B-[3-Methyl-4-(1-methylethyl)phenyl]boronic acid
Description:
B-[3-Methyl-4-(1-methylethyl)phenyl]boronic acid, with the CAS number 824390-17-2, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a methyl group and an isopropyl group. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with moderate solubility in polar organic solvents like methanol and ethanol. The boronic acid moiety allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and medicinal chemistry. Its structure contributes to its potential applications in drug development and materials science, particularly in the design of biologically active compounds. Additionally, the presence of the bulky isopropyl group may influence its reactivity and steric properties, affecting how it interacts with other molecules in chemical reactions. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H15BO2
InChI:InChI=1S/C10H15BO2/c1-7(2)10-5-4-9(11(12)13)6-8(10)3/h4-7,12-13H,1-3H3
InChI key:InChIKey=AALLJQCXECLAQR-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(C)=C(C(C)C)C=C1
Synonyms:- B-[3-Methyl-4-(1-methylethyl)phenyl]boronic acid
- Boronic acid, B-[3-methyl-4-(1-methylethyl)phenyl]-
- 3-Methyl-4-isopropylphenylboronic acid
- Boronic acid, [3-methyl-4-(1-methylethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
