CAS 824429-53-0
:N-[3-(Dimethoxymethyl)-2-pyridinyl]-2,2-dimethylpropanamide
Description:
N-[3-(Dimethoxymethyl)-2-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring and a dimethylpropanamide moiety. The presence of the dimethoxymethyl group contributes to its potential solubility in organic solvents and may influence its reactivity and biological activity. This compound is likely to exhibit polar characteristics due to the functional groups present, which can affect its interaction with other molecules. The amide functional group suggests that it may participate in hydrogen bonding, impacting its physical properties such as melting and boiling points. Additionally, the compound's molecular structure indicates potential applications in medicinal chemistry, possibly as a pharmaceutical agent or a precursor in organic synthesis. Its specific properties, such as stability, reactivity, and biological activity, would require further investigation through experimental studies and characterization techniques. Overall, this compound represents a class of organic molecules with diverse applications in chemical research and development.
Formula:C13H20N2O3
InChI:InChI=1S/C13H20N2O3/c1-13(2,3)12(16)15-10-9(7-6-8-14-10)11(17-4)18-5/h6-8,11H,1-5H3,(H,14,15,16)
InChI key:InChIKey=BINVXEAOQKKXFE-UHFFFAOYSA-N
SMILES:C(OC)(OC)C1=C(NC(C(C)(C)C)=O)N=CC=C1
Synonyms:- Propanamide, N-[3-(dimethoxymethyl)-2-pyridinyl]-2,2-dimethyl-
- N-[3-(Dimethoxymethyl)-2-pyridinyl]-2,2-dimethylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(3-Dimethoxymethyl-pyridin-2-yl)-2,2-dimethyl-propionamide
CAS:Formula:C13H20N2O3Molecular weight:252.3095
