
CAS 824429-55-2
:1-(3,4-Dihydro-6-iodo-1,8-naphthyridin-1(2H)-yl)-2,2-dimethyl-1-propanone
Description:
1-(3,4-Dihydro-6-iodo-1,8-naphthyridin-1(2H)-yl)-2,2-dimethyl-1-propanone, with the CAS number 824429-55-2, is a synthetic organic compound characterized by its complex structure, which includes a naphthyridine moiety and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the iodine atom may enhance its reactivity and influence its pharmacological properties. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound's lipophilicity is likely influenced by the bulky dimethyl groups, which can affect its solubility and permeability in biological systems. Additionally, the naphthyridine ring system is known for its role in medicinal chemistry, often associated with various therapeutic effects. Overall, this compound's unique structural features suggest potential applications in drug development and research, although specific biological activities would require further investigation.
Formula:C13H17IN2O
InChI:InChI=1S/C13H17IN2O/c1-13(2,3)12(17)16-6-4-5-9-7-10(14)8-15-11(9)16/h7-8H,4-6H2,1-3H3
InChI key:InChIKey=BJYMBIKIEYRROY-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(=O)N1C=2C(=CC(I)=CN2)CCC1
Synonyms:- 1-(6-Iodo-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-2,2-dimethylpropan-1-one
- 1-Propanone, 1-(3,4-dihydro-6-iodo-1,8-naphthyridin-1(2H)-yl)-2,2-dimethyl-
- 1,8-Naphthyridine, 1-(2,2-dimethyl-1-oxopropyl)-1,2,3,4-tetrahydro-6-iodo-
- 1-(6-Iodo-3,4-dihydro-2H-[1,8]naphthyridin-1-yl)-2,2-dimethyl-propan-1-one
- 1-(3,4-Dihydro-6-iodo-1,8-naphthyridin-1(2H)-yl)-2,2-dimethyl-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(6-Iodo-3,4-dihydro-2h-[1,8]naphthyridin-1-yl)-2,2-dimethyl-propan-1-one
CAS:Formula:C13H17IN2OMolecular weight:344.1913
