CAS 824430-78-6

1H-3-Benzazepine, 8-chloro-2,3,4,5-tetrahydro-1-methyl-, (1R)-, (2R,3R)-2,3-dihydroxybutanedioate (1:1)

Description:

1H-3-Benzazepine, 8-chloro-2,3,4,5-tetrahydro-1-methyl-, (1R)-, (2R,3R)-2,3-dihydroxybutanedioate (1:1) is a complex organic compound characterized by its unique bicyclic structure, which includes a benzazepine core. This compound features a chloro substituent at the 8-position and a methyl group at the 1-position of the benzazepine ring, contributing to its chemical reactivity and potential biological activity. The presence of the dihydroxybutanedioate moiety indicates that it has two hydroxyl groups and a dicarboxylic acid component, which may enhance its solubility and interaction with biological systems. The stereochemistry is specified by the (1R) and (2R,3R) designations, indicating specific three-dimensional arrangements of atoms that can influence the compound's pharmacological properties. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could be relevant for developing therapeutic agents. Its CAS number, 824430-78-6, allows for precise identification in chemical databases and literature.

Formula: C₁₁H₁₄ClN·C₄H₆O₆

InChI: InChI=1S/C11H14ClN.C4H6O6/c1-8-7-13-5-4-9-2-3-10(12)6-11(8)9;5-1(3(7)8)2(6)4(9)10/h2-3,6,8,13H,4-5,7H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t8-;1-,2-/m01/s1

InChI key: InChIKey=AYEYPPGCJSRUAN-YIDNRZKSSA-N

SMILES: C[C@@H]1C=2C(=CC=C(Cl)C2)CCNC1.[C@@H]([C@H](C(O)=O)O)(C(O)=O)O

Synonyms:

• 1H-3-Benzazepine, 8-chloro-2,3,4,5-tetrahydro-1-methyl-, (1R)-, (2R,3R)-2,3-dihydroxybutanedioate (1:1)

Lorcaserin L-Tartrate

CAS: 824430-78-6

Formula: C₁₁H₁₄ClN·C₄H₆O₆

Color and Shape: White To Off-White Solid

Molecular weight: 195.69 150.09

Ref: 4Z-L-095007