
CAS 82451-55-6
:Polyindole
Description:
Polyindole is a conducting polymer derived from the polymerization of indole monomers. It is characterized by its unique electrical conductivity, which can be attributed to the delocalized π-electron system within its structure. This property makes polyindole a candidate for various electronic applications, including sensors, transistors, and organic light-emitting diodes. The polymer typically exhibits good thermal stability and can be processed into various forms, such as films or fibers, enhancing its versatility in practical applications. Polyindole can also be doped with various agents to further enhance its conductivity and tailor its properties for specific uses. Additionally, it is known for its environmental stability and resistance to degradation, making it suitable for long-term applications. The synthesis of polyindole can be achieved through various methods, including chemical and electrochemical polymerization, allowing for control over its molecular weight and morphology. Overall, polyindole's combination of electrical, thermal, and mechanical properties positions it as a significant material in the field of organic electronics and advanced materials.
Formula:(C8H7N)x
InChI:InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H
InChI key:InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N
SMILES:C1=2C(NC=C1)=CC=CC2
Synonyms:- Polyindole
- Indole homopolymer
- 1H-Indole, homopolymer
- Indole polymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
