
CAS 82451-56-7
:Polyazulene
Description:
Polyazulene is a synthetic polymer characterized by its unique structure derived from azulene, a bicyclic aromatic hydrocarbon. This polymer exhibits distinctive properties, including a deep blue color, which is attributed to its conjugated system of alternating double bonds. Polyazulene is known for its high thermal stability and good solubility in various organic solvents, making it suitable for applications in organic electronics and photonic devices. Additionally, it demonstrates interesting electrical conductivity and can exhibit semiconducting behavior, which is valuable in the development of organic semiconductors. The polymer's optical properties, including its ability to absorb light in the visible spectrum, make it a candidate for use in light-emitting devices and sensors. Furthermore, polyazulene can undergo various chemical modifications, allowing for the tuning of its properties for specific applications. Overall, polyazulene's unique characteristics position it as a versatile material in advanced material science and nanotechnology.
Formula:(C10H8)x
InChI:InChI=1S/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H
InChI key:InChIKey=CUFNKYGDVFVPHO-UHFFFAOYSA-N
SMILES:C1=2C(=CC=C1)C=CC=CC2
Synonyms:- Polyazulene
- Azulene polymer
- Azulene, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
