CAS 82452-93-5
:Calix[8]arene
Description:
Calix[8]arene is a macrocyclic compound belonging to the calixarene family, characterized by its unique structure formed by phenolic units linked by methylene bridges. This compound typically exhibits a bowl-shaped conformation, which allows it to act as a host molecule for various guest species, including cations and anions, due to its ability to form non-covalent interactions such as hydrogen bonding and π-π stacking. Calix[8]arene is soluble in organic solvents and can be functionalized at various positions on the aromatic rings, enhancing its selectivity and binding properties. Its applications span across fields such as supramolecular chemistry, sensor technology, and drug delivery systems, where it serves as a versatile scaffold for the design of molecular receptors. Additionally, the compound's ability to encapsulate ions and small molecules makes it a subject of interest in the development of separation processes and catalysis. Overall, calix[8]arene's structural versatility and functionalization potential make it a valuable compound in both research and industrial applications.
Formula:C56H48O8
InChI:InChI=1/C56H48O8/c57-49-33-9-1-10-34(49)26-36-12-3-14-38(51(36)59)28-40-16-5-18-42(53(40)61)30-44-20-7-22-46(55(44)63)32-48-24-8-23-47(56(48)64)31-45-21-6-19-43(54(45)62)29-41-17-4-15-39(52(41)60)27-37-13-2-11-35(25-33)50(37)58/h1-24,57-64H,25-32H2
SMILES:c1cc2Cc3cccc(Cc4cccc(Cc5cccc(Cc6cccc(Cc7cccc(Cc8cccc(Cc9cccc(Cc(c1)c2O)c9O)c8O)c7O)c6O)c5O)c4O)c3O
Synonyms:- Nonacyclo[43.3.1.1~3,7~.1~9,13~.1~15,19~.1~21,25~.1~27,31~.1~33,37~.1~39,43~]hexapentaconta-1(49),3(56),4,6,9(55),10,12,15(54),16,18,21(53),22,24,27(52),28,30,33(51),34,36,39(50),40,42,45,47-tetracosaene-49,50,51,52,53,54,55,56-octol
- Nonacyclo[43.3.1.1~3,7~.1~9,13~.1~15,19~.1~21,25~.1~27,31~.1~33,37~.1~39,43~]Hexapentaconta-1(49),3,5,7(56),9,11,13(55),15,17,19(54),21,23,25(53),27,29,31(52),33,35,37(51),39,41,43(50),45,47-Tetracosaene-49,50,51,52,53,54,55,56-Octol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Calix[8]arene, 97%
CAS:It is used in the study on the chromatographic behavior of water-soluble vitamins on p-tert-butyl-calix [8] arene-bonded silica gel stationary phase by HPLC. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label informatiFormula:C56H48O8Purity:97%Color and Shape:White to cream, PowderMolecular weight:848.99


