
CAS 82452-99-1
:4-Chloro-3-iodocinnoline
Description:
4-Chloro-3-iodocinnoline is an organic compound characterized by its unique structure, which includes a cinnoline core substituted with chlorine and iodine atoms. This compound typically exhibits a pale yellow to brownish color and is known for its potential applications in medicinal chemistry and material science. The presence of halogen substituents, specifically chlorine and iodine, can influence its reactivity and biological activity, making it a subject of interest in various chemical research fields. 4-Chloro-3-iodocinnoline may exhibit properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, including halogenation and cyclization reactions. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental impact. Overall, 4-Chloro-3-iodocinnoline represents a valuable compound for further investigation in both academic and industrial settings.
Formula:C8H4ClIN2
InChI:InChI=1S/C8H4ClIN2/c9-7-5-3-1-2-4-6(5)11-12-8(7)10/h1-4H
InChI key:InChIKey=DEOSDIOOYNWSMJ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=NC1I)C=CC=C2
Synonyms:- 4-Chloro-3-iodocinnoline
- Cinnoline, 4-chloro-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
