CAS 82460-75-1
:Isodonoiol
Description:
Isodonoiol, with the CAS number 82460-75-1, is a naturally occurring organic compound classified as a sesquiterpene alcohol. It is primarily derived from various plant sources, particularly those in the Lamiaceae family. Isodonoiol is characterized by its complex molecular structure, which includes multiple chiral centers, contributing to its stereochemical diversity. This compound is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmacological research. Isodonoiol typically exhibits a pleasant, herbal aroma, which may contribute to its use in perfumery and flavoring applications. Its solubility characteristics can vary, often being more soluble in organic solvents than in water. As with many natural products, the extraction and purification processes can influence its yield and purity, which are critical for both research and commercial applications. Overall, Isodonoiol represents a fascinating subject of study within the field of natural products chemistry due to its diverse applications and potential health benefits.
Formula:C22H30O7
InChI:InChI=1S/C22H30O7/c1-11-13-7-14(25)17-21(8-13,18(11)26)19(27)29-16-5-6-20(3,4)15(9-23)22(16,17)10-28-12(2)24/h13-17,23,25H,1,5-10H2,2-4H3
InChI key:InChIKey=OCELUFZNLBUKGF-UHFFFAOYSA-N
SMILES:C(OC(C)=O)C12C3C4(CC(CC3O)C(=C)C4=O)C(=O)OC1CCC(C)(C)C2CO
Synonyms:- (5α)-8-(Acetyloxy)-8,10-deepoxy-13-deoxy-5-hydroxyenmein
- 6H-6a,9-Methanobenzo[b]cyclohepta[d]pyran, enmein deriv.
- Rabdophyllin G
- Enmein, 8-(acetyloxy)-8,10-deepoxy-13-deoxy-5-hydroxy-, (5α)-
- Rabdosin C
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Rabdosin C
CAS:Rabdosin C is an antineoplastic isolated from the leaves of Rabdosia japonic.Formula:C22H30O7Purity:98%Color and Shape:SolidMolecular weight:406.475Rabdophyllin G
CAS:Rabdophyllin G is a bioactive compound, which is derived from microbial fermentation processes. It functions as a modulator of cellular signaling pathways, exerting its effects primarily through interaction with specific cellular receptors and altering enzymatic activity. Rabdophyllin G's mode of action involves the regulation of key signal transduction pathways, influencing gene expression and protein synthesis, which in turn affects various metabolic and physiological responses.Formula:C22H30O7Purity:Min. 95%Molecular weight:406.47 g/mol

