CAS 82465-53-0

3,3-Dimethyl-1-(3-pyridinyl)-1-butanone

Description:

3,3-Dimethyl-1-(3-pyridinyl)-1-butanone, with the CAS number 82465-53-0, is an organic compound that belongs to the class of ketones. It features a butanone backbone substituted with a pyridine ring and two methyl groups at the 3-position. This compound is characterized by its distinctive structural features, which contribute to its chemical properties, including its reactivity and potential applications in various fields such as pharmaceuticals and agrochemicals. The presence of the pyridine moiety may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests it may exhibit moderate polarity, influencing its solubility in organic solvents. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its identity and purity. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₁H₁₅NO

InChI: InChI=1S/C11H15NO/c1-11(2,3)7-10(13)9-5-4-6-12-8-9/h4-6,8H,7H2,1-3H3

InChI key: InChIKey=CAJFVHCPURUCOR-UHFFFAOYSA-N

SMILES: C(CC(C)(C)C)(=O)C=1C=CC=NC1

Synonyms:

• 1-Butanone, 3,3-dimethyl-1-(3-pyridinyl)-
• 3,3-Dimethyl-1-(3-pyridinyl)-1-butanone