CAS 82467-50-3
:Gomisin M1
Description:
Gomisin M1 is a lignan compound primarily derived from the fruit of the Schisandra chinensis plant, known for its traditional use in herbal medicine. It exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential neuroprotective effects. Gomisin M1 is characterized by its complex molecular structure, which contributes to its pharmacological properties. The compound has garnered interest in research for its potential therapeutic applications, particularly in the fields of cancer treatment and neurodegenerative diseases. Its mechanism of action may involve modulation of various signaling pathways and the inhibition of oxidative stress. Additionally, Gomisin M1 is being studied for its effects on metabolic processes and its role in enhancing cognitive function. As with many natural products, the bioavailability and efficacy of Gomisin M1 can be influenced by factors such as formulation and dosage. Overall, Gomisin M1 represents a promising area of study in natural product chemistry and pharmacology, with ongoing research aimed at elucidating its full potential and mechanisms of action.
Formula:C22H26O6
InChI:InChI=1S/C22H26O6/c1-11-6-13-8-15(24-3)20(25-4)19(23)17(13)18-14(7-12(11)2)9-16-21(22(18)26-5)28-10-27-16/h8-9,11-12,23H,6-7,10H2,1-5H3
InChI key:InChIKey=OGJPBGDUYKEQLA-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C(=CC(OC)=C(OC)C3O)CC(C)C(C)CC2=CC4=C1OCO4
Synonyms:- (?à)-Gomisin M1
- (±)-Gomisin M<sub>1</sub>
- Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-1-ol,5,6,7,8-tetrahydro-2,3,13-trimethoxy-6,7-dimethyl-, stereoisomer
- Gomisin M1
- R(+)-Gomisin M1
- rel-(6R,7S,13aR)-5,6,7,8-Tetrahydro-2,3,13-trimethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-1-ol
- Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-1-ol, 5,6,7,8-tetrahydro-2,3,13-trimethoxy-6,7-dimethyl-, (6R,7S,13aR)-rel-
- Gomisin M
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
R(+)-Gomisin M1
CAS:Controlled ProductGomisin M1 is a molecule that has been extracted from the schizandra fruit. It is a β-unsaturated ketone that has anti-aging properties, and has been shown to have drug transporter properties in cells. Gomisin M1 also inhibits cancer cell growth by inhibiting the synthesis of DNA, RNA, and proteins. Gomisin M1 is a metabolite of gomisin A, which is found in the schisandra fruit. Gomisin A contains a hydroxyl group with an aryl halide at its top and bottom positions on the phenyl ring. The molecule also contains an α-ring and a β-ring that are both unsaturated, as well as an oxygenated group at position 3 on the biphenyl ring.Formula:C22H26O6Purity:Min. 95%Molecular weight:386.44 g/mol


