CAS 82467-52-5
:(+)-Schisandrin B
Description:
(+)-Schisandrin B is a natural compound classified as a lignan, primarily derived from the fruit of the Schisandra chinensis plant, commonly known for its medicinal properties in traditional Chinese medicine. This compound exhibits a complex molecular structure characterized by multiple aromatic rings and hydroxyl groups, contributing to its biological activity. (+)-Schisandrin B is known for its antioxidant properties, which help in scavenging free radicals and reducing oxidative stress. Additionally, it has been studied for its potential neuroprotective effects, anti-inflammatory properties, and ability to enhance liver function. The compound is often explored for its role in promoting overall health and wellness, particularly in the context of stress resistance and immune support. Its solubility characteristics typically indicate that it is more soluble in organic solvents than in water, which is common for many lignans. As research continues, (+)-Schisandrin B may reveal further therapeutic applications, underscoring the importance of natural products in pharmacology.
Formula:C23H28O6
InChI:InChI=1S/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3
InChI key:InChIKey=RTZKSTLPRTWFEV-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C(=CC(OC)=C(OC)C3OC)CC(C)C(C)CC2=CC4=C1OCO4
Synonyms:- Isokadsuranin
- (6R,7S,13aR)-5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxole
- (+)-Schisandrin B
- Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxole, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, (6R,7S,13aR)-
- Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxole, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, stereoisomer
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Isokadsuranin
CAS:Controlled Product<p>Isokadsuranin is a natural product that has been identified as a potential anticancer agent. It is a gomisin, which is a type of flavonoid that can be found in plants. Isokadsuranin has been shown to have bioactive compounds and demethylase activity, which may make it an effective treatment for inflammation. The pi3k/akt pathway, which regulates cell growth and proliferation, was found to be inhibited by this compound. Isokadsuranin also showed anti-inflammatory activity in mouse studies and the primary liver cancer cell line HepG2 cells. This drug increased the levels of ATP in both mitochondria and the microsomes of hepatocytes at low concentrations. It also caused DNA damage in primary liver cancer cells and decreased ATP levels in these cells at high concentrations.</p>Purity:Min. 95%
