CAS 82483-66-7

Methyl 4-formyl-2,3-dihydro-1H-pyrrole-1-carboxylate

Description:

Methyl 4-formyl-2,3-dihydro-1H-pyrrole-1-carboxylate, identified by its CAS number 82483-66-7, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features a formyl group (-CHO) and a carboxylate ester (-COOCH3) substituent, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the formyl group suggests that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions, making it useful in the synthesis of more complex organic molecules. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its solubility in organic solvents and stability under standard laboratory conditions further enhance its utility in research and industrial applications. Proper handling and storage are essential due to potential reactivity and safety considerations associated with its functional groups.

Formula: C₇H₉NO₃

InChI: InChI=1S/C7H9NO3/c1-11-7(10)8-3-2-6(4-8)5-9/h4-5H,2-3H2,1H3

InChI key: InChIKey=ZUCGWYMLVMUVIZ-UHFFFAOYSA-N

SMILES: C(OC)(=O)N1C=C(C=O)CC1

Synonyms:

• 1H-Pyrrole-1-carboxylic acid, 4-formyl-2,3-dihydro-, methyl ester
• Methyl 4-formyl-2,3-dihydro-1H-pyrrole-1-carboxylate