CAS 82486-43-9

(6E)-4-bromo-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one

Description:

(6E)-4-bromo-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one is a chemical compound characterized by its unique structural features, including a bromine atom and a hydroxyamino group attached to a cyclohexadiene framework. This compound exhibits a conjugated system, which contributes to its potential reactivity and stability under certain conditions. The presence of the hydroxyamino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The compound's structure indicates that it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the bromine substituent can enhance the compound's electrophilic character, making it useful in further chemical transformations. Its specific properties, such as solubility, melting point, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, this compound represents a fascinating example of a brominated organic molecule with potential utility in chemical research and applications.

Formula: C₇H₆BrNO₂

InChI: InChI=1/C7H6BrNO2/c8-6-1-2-7(10)5(3-6)4-9-11/h1-4,9,11H/b5-4+

Synonyms:

• 5-Bromosalicylaldehyde oxime
• 2-Hydroxy-5-bromobenzaldehyde oxime
• 5-Bromosalicylaldoxime
• 4-bromo-2-[(1E)-(hydroxyimino)methyl]phenol
• Benzaldehyde, 5-bromo-2-hydroxy-, oxime
• 5-BROMO-2-HYDROXYBENZALDEHYDE OXIME

5-Bromo-2-hydroxybenzaldehyde Oxime

CAS: 82486-43-9

Formula: C₇H₆BrNO₂

Molecular weight: 216.0320

Ref: IN-DA00G9LT

5-Bromo-2-hydroxybenzaldehyde oxime

CAS: 82486-43-9

Versatile small molecule scaffold

Formula: C₇H₆BrNO₂

Purity: Min. 95%

Molecular weight: 216.03 g/mol

Ref: 3D-HDA48643