CAS 82495-70-3
:(S)-(-)-N-(1-(hydroxymethyl)-2-phenyl-ethyl)-4-me
Description:
The chemical substance known as (S)-(-)-N-(1-(hydroxymethyl)-2-phenyl-ethyl)-4-methylbenzamide, with the CAS number 82495-70-3, is an organic compound characterized by its chiral structure, which includes a hydroxymethyl group and a phenyl group attached to a central carbon atom. This compound features an amide functional group, which contributes to its potential biological activity and solubility properties. The presence of the methylbenzamide moiety suggests that it may exhibit hydrophobic characteristics, influencing its interactions in biological systems. As a chiral molecule, it may display different pharmacological effects depending on its stereochemistry, making it relevant in medicinal chemistry and drug development. The compound's specific applications and behavior in various chemical environments would depend on its interactions with other molecules, including potential binding to biological targets. Overall, this compound exemplifies the complexity and diversity of organic molecules used in pharmaceutical research and development.
Formula:C16H19NO3S
InChI:InChI=1/C16H19NO3S/c1-13-7-9-16(10-8-13)21(19,20)17-15(12-18)11-14-5-3-2-4-6-14/h2-10,15,17-18H,11-12H2,1H3/t15-/m0/s1
SMILES:Cc1ccc(cc1)S(=O)(=O)N[C@@H](Cc1ccccc1)CO
Synonyms:- (S)-()-N-[1-(Hydroxymethyl)-2-phenylethyl]-4-methylbenzenesulfonamide
- N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-4-methylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(S)-(-)-N-[1-(Hydroxymethyl)-2-phenylethyl]-4-methylbenzenesulfonamide
CAS:Formula:C16H19NO3SMolecular weight:305.392

