CAS 824958-12-5
:1-Piperazinehexanamide, 4-[2-(methylthio)phenyl]-N-(1,2,3,4-tetrahydro-1-naphthalenyl)-, hydrochloride (1:1)
Description:
1-Piperazinehexanamide, 4-[2-(methylthio)phenyl]-N-(1,2,3,4-tetrahydro-1-naphthalenyl)-, hydrochloride (1:1), with CAS number 824958-12-5, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a naphthalene derivative. This compound typically exhibits properties associated with both amides and piperazines, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of amide functional groups. The methylthio group may contribute to its lipophilicity, influencing its biological activity and interaction with various receptors. As a hydrochloride salt, it is likely to be more stable and soluble in aqueous environments, which is advantageous for pharmaceutical applications. The compound may be of interest in medicinal chemistry, particularly for its potential therapeutic effects, but specific biological activities and mechanisms would require further investigation through empirical studies. Overall, its unique structural features suggest a range of possible applications in drug development and research.
Formula:C27H37N3OS·ClH
InChI:InChI=1S/C27H37N3OS.ClH/c1-32-26-15-7-6-14-25(26)30-20-18-29(19-21-30)17-8-2-3-16-27(31)28-24-13-9-11-22-10-4-5-12-23(22)24;/h4-7,10,12,14-15,24H,2-3,8-9,11,13,16-21H2,1H3,(H,28,31);1H
InChI key:InChIKey=DWGKCWWWKHCVDH-UHFFFAOYSA-N
SMILES:N(C(CCCCCN1CCN(CC1)C2=C(SC)C=CC=C2)=O)C3C=4C(CCC3)=CC=CC4.Cl
Synonyms:- 1-Piperazinehexanamide, 4-[2-(methylthio)phenyl]-N-(1,2,3,4-tetrahydro-1-naphthalenyl)-, monohydrochloride
- 1-Piperazinehexanamide,4-[2-(methylthio)phenyl]-N-(1,2,3,4-tetrahydro-1-naphthalenyl)-,monohydrochloride (9CI)
- 1-Piperazinehexanamide, 4-[2-(methylthio)phenyl]-N-(1,2,3,4-tetrahydro-1-naphthalenyl)-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
LP 44 Hydrochloride
CAS:Controlled ProductFormula:C27H37N3OS·HClColor and Shape:NeatMolecular weight:488.128LP 44 Hydrochloride
CAS:LP 44 Hydrochloride is a synthetic chemical compound, which is commonly used as a specific agonist in scientific research. It originates from laboratory synthesis, designed to selectively interact with certain biological pathways. The mode of action for LP 44 Hydrochloride involves binding to specific receptor sites, thereby modulating the activity of these receptors to elucidate biological functions and processes within experimental systems.Formula:C27H38ClN3OSPurity:Min. 95%Molecular weight:488.13 g/molLP44 hydrochloride
CAS:LP44 hydrochloride is a 5-HT7 agonist with analgesic effects on formalin-induced orofacial pain in mice and can be used to study neuroinflammation.Formula:C27H38ClN3OSPurity:98.06%Color and Shape:SolidMolecular weight:488.13



