CAS 824961-53-7
:5-(4-chlorophenyl)-1-methyl-1H-pyrrole-2-carbaldehyde
Description:
5-(4-Chlorophenyl)-1-methyl-1H-pyrrole-2-carbaldehyde is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a 4-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring, enhancing the compound's reactivity and potentially influencing its biological activity. The aldehyde functional group (-CHO) at the 2-position of the pyrrole ring is significant for its reactivity, allowing for various chemical transformations, including condensation and oxidation reactions. This compound may exhibit interesting properties due to the electron-withdrawing nature of the chlorine substituent, which can affect the electronic distribution within the molecule. It is likely to be soluble in organic solvents and may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex organic molecules. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity or reactivity.
Formula:C12H10ClNO
InChI:InChI=1/C12H10ClNO/c1-14-11(8-15)6-7-12(14)9-2-4-10(13)5-3-9/h2-8H,1H3
SMILES:Cn1c(ccc1c1ccc(cc1)Cl)C=O
Synonyms:- 1H-pyrrole-2-carboxaldehyde, 5-(4-chlorophenyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(4-Chlorophenyl)-1-methyl-1H-pyrrole-2-carbaldehyde
CAS:Formula:C12H10ClNOMolecular weight:219.6669
