CAS 824981-40-0

1-(4-ethylbenzyl)-5-oxopyrrolidine-3-carboxylic acid

Description:

1-(4-Ethylbenzyl)-5-oxopyrrolidine-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a carboxylic acid group and an ethylbenzyl moiety. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The pyrrolidine ring contributes to its cyclic nature, which can influence its conformational stability and biological activity. Compounds of this type may be of interest in medicinal chemistry, particularly for their potential pharmacological properties. The presence of the ethylbenzyl group may enhance lipophilicity, affecting the compound's interaction with biological membranes. Overall, the characteristics of this compound suggest it could be relevant in various chemical and pharmaceutical applications, although specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise details.

Formula: C₁₄H₁₇NO₃

InChI: InChI=1/C14H17NO3/c1-2-10-3-5-11(6-4-10)8-15-9-12(14(17)18)7-13(15)16/h3-6,12H,2,7-9H2,1H3,(H,17,18)

SMILES: CCc1ccc(cc1)CN1CC(CC1=O)C(=O)O

Synonyms:

• 3-Pyrrolidinecarboxylic Acid, 1-[(4-Ethylphenyl)Methyl]-5-Oxo-
• 1-(4-Ethylbenzyl)-5-oxopyrrolidine-3-carboxylic acid