CAS 82499-60-3

[(4-bromobenzyl)oxy]acetic acid

Description:

[(4-bromobenzyl)oxy]acetic acid, with the CAS number 82499-60-3, is an organic compound characterized by the presence of a bromobenzyl group attached to an acetic acid moiety through an ether linkage. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities. The bromine atom in the para position of the benzyl ring can influence the compound's reactivity and polarity, potentially enhancing its electrophilic character. The presence of the carboxylic acid group contributes to its acidity and solubility in polar solvents. This compound may be utilized in various chemical syntheses, including the development of pharmaceuticals or as an intermediate in organic reactions. Its structural features suggest potential applications in medicinal chemistry, particularly in the design of biologically active molecules. Additionally, the bromine substituent may impart unique properties, such as increased lipophilicity or specific interactions with biological targets. Overall, [(4-bromobenzyl)oxy]acetic acid is a versatile compound with significant implications in chemical research and development.

Formula: C₉H₉BrO₃

InChI: InChI=1/C9H9BrO3/c10-8-3-1-7(2-4-8)5-13-6-9(11)12/h1-4H,5-6H2,(H,11,12)

SMILES: c1cc(ccc1COCC(=O)O)Br

Synonyms:

• 2-[(4-Bromobenzyl)Oxy]Acetic Acid
• Acetic Acid, 2-[(4-Bromophenyl)Methoxy]-
• [(4-Bromobenzyl)oxy]acetic acid
• p-bromobenzyloxyacetic acid

(4-Bromo-benzyloxy)-acetic acid

CAS: 82499-60-3

(4-Bromo-benzyloxy)-acetic acid

Purity: 95%

Molecular weight: 245.073g/mol

Ref: 54-OR97585

(4-Bromo-benzyloxy)-acetic acid

CAS: 82499-60-3

Formula: C₉H₉BrO₃

Purity: 95.0%

Molecular weight: 245.072

Ref: 10-F522006