CAS 825-03-6

2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid

Description:

2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic acid, with the CAS number 825-03-6, is an organic compound characterized by its bicyclic structure, which consists of a seven-membered ring system featuring a double bond and a carboxylic acid functional group. This compound is notable for its unique bicyclic framework, which contributes to its chemical reactivity and potential applications in organic synthesis. The presence of the carboxylic acid group indicates that it can participate in various chemical reactions, such as esterification and acid-base reactions. Additionally, the methyl group attached to the bicyclic structure can influence the compound's steric and electronic properties, affecting its reactivity and interactions with other molecules. 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic acid may also exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and natural product synthesis. Its physical properties, such as solubility and boiling point, would depend on the specific conditions and the presence of other functional groups.

Formula: C₉H₁₁O₂

InChI: InChI=1/C9H12O2/c1-9(8(10)11)5-6-2-3-7(9)4-6/h2-3,6-7H,4-5H2,1H3,(H,10,11)/p-1/t6-,7-,9-/m1/s1

SMILES: C[C@]1(C[C@@H]2C=C[C@@H]1C2)C(=O)[O-]

Synonyms:

• 2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid
• 5-Methyl-2-norbornene-5-carboxylic Acid
• (1S,2S,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate
• (1S,2R,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate

2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid

CAS: 825-03-6

2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid

Purity: 95%

Ref: 54-OR1043883

2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid

CAS: 825-03-6

Versatile small molecule scaffold

Formula: C₉H₁₂O₂

Purity: Min. 95%

Molecular weight: 152.19 g/mol

Ref: 3D-AAA82503