CAS 82501-28-8

3-tert-butyl-4H-indeno[1,2-c][1,2]oxazol-4-one

Description:

3-tert-butyl-4H-indeno[1,2-c][1,2]oxazol-4-one is a heterocyclic organic compound characterized by its unique fused ring structure, which includes an indeno framework and an oxazole moiety. This compound typically exhibits a solid-state appearance and is known for its potential applications in organic synthesis and materials science due to its interesting electronic properties. The presence of the tert-butyl group enhances its solubility and stability, making it suitable for various chemical reactions. Additionally, the oxazole ring contributes to its reactivity, particularly in cycloaddition and electrophilic substitution reactions. The compound may also display fluorescence, which can be advantageous in applications such as sensors or dyes. Its chemical behavior is influenced by the functional groups present, and it may participate in various interactions, including hydrogen bonding and π-π stacking, which can affect its physical properties and reactivity. Overall, 3-tert-butyl-4H-indeno[1,2-c][1,2]oxazol-4-one is a versatile compound with significant potential in both research and industrial applications.

Formula: C₁₄H₁₃NO₂

InChI: InChI=1/C14H13NO2/c1-14(2,3)13-10-11(15-17-13)8-6-4-5-7-9(8)12(10)16/h4-7H,1-3H3

SMILES: CC(C)(C)c1c2c(c3ccccc3C2=O)no1

Synonyms:

• 3-tert-Butyl-4H-indeno(1,2-c)isoxazol-4-one

3-(tert-butyl)indeno[3,2-c]isoxazol-4-one

CAS: 82501-28-8

Please enquire for more information about 3-(tert-butyl)indeno[3,2-c]isoxazol-4-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₁₃NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 227.26 g/mol

Ref: 3D-FB169751