CAS 82506-99-8

1-Chloro-2,3-butanedione 2,3-dioxime

Description:

1-Chloro-2,3-butanedione 2,3-dioxime, with the CAS number 82506-99-8, is a chemical compound characterized by its unique functional groups and structural features. It contains a chloro substituent and two dioxime groups, which are derived from the oxidation of ketones. This compound is typically a solid at room temperature and is known for its potential applications in organic synthesis and coordination chemistry. The presence of the dioxime functional groups imparts chelating properties, allowing it to form complexes with various metal ions, which can be useful in analytical chemistry and metal extraction processes. Additionally, the chloro group can participate in nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. The compound's reactivity and stability can be influenced by factors such as pH and the presence of other chemical species. Overall, 1-Chloro-2,3-butanedione 2,3-dioxime is a valuable compound in both research and industrial applications due to its distinctive chemical properties.

Formula: C₄H₇ClN₂O₂

InChI: InChI=1S/C4H7ClN2O2/c1-3(6-8)4(2-5)7-9/h8-9H,2H2,1H3

InChI key: InChIKey=ZBMQRQACJNHGNB-UHFFFAOYSA-N

SMILES: C(C(=NO)C)(CCl)=NO

Synonyms:

• 2,3-Butanedione, 1-chloro-, dioxime
• 1-Chloro-2,3-butanedione 2,3-dioxime
• Glyoxime, (chloromethyl)methyl-
• 2,3-Butanedione, 1-chloro-, 2,3-dioxime

N-[1-Chloro-3-(hydroxyimino)butan-2-ylidene]hydroxylamine

CAS: 82506-99-8

Versatile small molecule scaffold

Formula: C₄H₇ClN₂O₂

Purity: Min. 95%

Molecular weight: 150.56 g/mol

Ref: 3D-HDA50699