CAS 82508-31-4
:Pseudolaric acid B
Description:
Pseudolaric acid B is a natural compound classified as a triterpenoid, primarily derived from the wood of the Pseudolarix amabilis tree, commonly known as the golden larch. This compound is notable for its complex structure, which includes multiple rings and functional groups that contribute to its biological activity. Pseudolaric acid B exhibits various pharmacological properties, including anti-inflammatory, antifungal, and potential anticancer effects, making it a subject of interest in medicinal chemistry and natural product research. Its mechanism of action often involves modulation of cellular pathways, although specific targets may vary. The compound is typically studied in the context of traditional medicine and modern therapeutic applications. In terms of physical properties, Pseudolaric acid B is generally characterized by its solubility in organic solvents and limited solubility in water, which is common for many triterpenoids. As research continues, the potential applications and mechanisms of action of Pseudolaric acid B may provide insights into new therapeutic strategies.
Formula:C23H28O8
InChI:InChI=1S/C23H28O8/c1-14(18(25)26)6-5-10-21(3)17-9-12-22(20(28)31-21)11-7-16(19(27)29-4)8-13-23(17,22)30-15(2)24/h5-7,10,17H,8-9,11-13H2,1-4H3,(H,25,26)/b10-5+,14-6+/t17-,21+,22+,23-/m0/s1
InChI key:InChIKey=VDGOFNMYZYBUDT-YDRCMHEVSA-N
SMILES:O(C(C)=O)[C@]12[C@]3(C(=O)O[C@@](/C=C/C=C(/C(O)=O)\C)(C)[C@@]1(CC3)[H])CC=C(C(OC)=O)CC2
Synonyms:- (2E,4E)-5-[(3R,4R,4aS,9aR)-4a,7-bis(methoxycarbonyl)-3-methyl-1-oxo-3,4,4a,5,6,9-hexahydro-4,9a-ethanocyclohepta[c]pyran-3(1H)-yl]-2-methylpenta-2,4-dienoic acid
- (2E,4E)-5-[(4aS)-4a-(acetyloxy)-7-(methoxycarbonyl)-3-methyl-1-oxo-3,4,4a,5,6,9-hexahydro-4,9a-ethanocyclohepta[c]pyran-3(1H)-yl]-2-methylpenta-2,4-dienoic acid
- 1H-4,9a-Ethanocyclohepta[c]pyran-7-carboxylic acid, 4a-(acetyloxy)-3-(4-carboxy-1,3-pentadienyl)-3,4,4a,5,6,9-hexahydro-3-methyl-1-oxo-, 7-methyl ester, [3R-[3α(1E,3E),4α,4aα,9aα]]-
- 1H-4,9a-Ethanocyclohepta[c]pyran-7-carboxylic acid, 4a-(acetyloxy)-3-[(1E,3E)-4-carboxy-1,3-pentadien-1-yl]-3,4,4a,5,6,9-hexahydro-3-methyl-1-oxo-, 7-methyl ester, (3R,4S,4aS,9aR)-
- 1H-4,9a-Ethanocyclohepta[c]pyran-7-carboxylic acid, 4a-(acetyloxy)-3-[(1E,3E)-4-carboxy-1,3-pentadienyl]-3,4,4a,5,6,9-hexahydro-3-methyl-1-oxo-, 7-methyl ester, (3R,4S,4aS,9aR)-
- NSC 615488
- O-Acetylpseudolaric acid C
- Pseudolarix acid B
- Pseudolaric acid B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Pseudolaric Acid B
CAS:Pseudolaric acid B, a natural diterpenoid compound, is isolated from Pseudolarix kaempferi.Formula:C23H28O8Purity:98.91% - 99.84%Color and Shape:SolidMolecular weight:432.46Pseudolaric acid b
CAS:LactoneFormula:C23H28O8Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:432.47Pseudolaric acid B
CAS:<p>Pseudolaric acid B is a diterpenoid acid, which is isolated from the roots and bark of the Pseudolarix amabilis, a tree native to China. This compound exhibits a complex mode of action, primarily disrupting microtubule dynamics, which interferes with cell division. Pseudolaric acid B targets the polymerization of tubulin, thereby inhibiting mitotic spindle formation and leading to cell cycle arrest. Its bioactivity has been extensively studied for its potential applications in both anti-fungal and anti-cancer therapies. In the context of cancer research, pseudolaric acid B is of particular interest due to its ability to selectively induce apoptosis in tumor cells. As an anti-fungal agent, it has been shown to possess efficacy against various pathogenic fungi, offering potential utility in agricultural contexts as well. The multi-faceted mechanisms of action and broad application possibilities make Pseudolaric acid B a subject of ongoing research in pharmacology and biotechnology.</p>Formula:C23H28O8Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:432.46 g/mol
