CAS 82508-34-7

Methyl pseudolarate B

Description:

Methyl pseudolarate B is a chemical compound derived from the plant species *Pseudolarix amabilis*, commonly known for its traditional medicinal uses. It belongs to the class of compounds known as terpenoids, which are characterized by their diverse structures and biological activities. Methyl pseudolarate B is recognized for its potential pharmacological properties, including anti-inflammatory and anti-tumor effects, making it of interest in medicinal chemistry and drug development. The compound typically exhibits moderate solubility in organic solvents, which is common for terpenoids, and may have limited solubility in water. Its molecular structure features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its unique chemical behavior and interactions. As with many natural products, the extraction and purification processes can influence its yield and activity, necessitating careful handling and analysis in laboratory settings. Overall, methyl pseudolarate B represents a fascinating area of study within natural product chemistry and its applications in health sciences.

Formula: C₂₄H₃₀O₈

InChI: InChI=1S/C24H30O8/c1-15(19(26)29-4)7-6-11-22(3)18-10-13-23(21(28)32-22)12-8-17(20(27)30-5)9-14-24(18,23)31-16(2)25/h6-8,11,18H,9-10,12-14H2,1-5H3/b11-6+,15-7+/t18-,22+,23+,24-/m0/s1

InChI key: InChIKey=DXNRJQIZAXOHQJ-KYNXZXPVSA-N

SMILES: O(C(C)=O)[C@]12[C@@]3(CC[C@]1([C@](/C=C/C=C(/C(OC)=O)\C)(C)OC3=O)[H])CC=C(C(OC)=O)CC2

Synonyms:

• Methyl pseudolarate B
• 1H-4,9a-Ethanocyclohepta[c]pyran-7-carboxylic acid, 4a-(acetyloxy)-3,4,4a,5,6,9-hexahydro-3-[(1E,3E)-5-methoxy-4-methyl-5-oxo-1,3-pentadien-1-yl]-3-methyl-1-oxo-, methyl ester, (3R,4S,4aS,9aR)-
• 1H-4,9a-Ethanocyclohepta[c]pyran-7-carboxylic acid, 4a-(acetyloxy)-3,4,4a,5,6,9-hexahydro-3-[(1E,3E)-5-methoxy-4-methyl-5-oxo-1,3-pentadienyl]-3-methyl-1-oxo-, methyl ester, (3R,4S,4aS,9aR)-
• 1H-4,9a-Ethanocyclohepta[c]pyran-7-carboxylic acid, 4a-(acetyloxy)-3-(5-methoxy-4-methyl-5-oxo-1,3-pentadienyl)-3,4,4a,5,6,9a-hexahydro-3-methyl-1-oxo-, methyl ester, [3α(1E,3E),4α,4aα,9aα]-
• Methylpseudolarate B

Methylpseudolarate B

CAS: 82508-34-7

Formula: C₂₄H₃₀O₈

Purity: 98.0%

Molecular weight: 446.4902

Ref: IN-DA00G686

Methyl pseudolarate B

CAS: 82508-34-7

Methyl pseudolarate B is a natural product of Pseudolarix, Pinaceae.

Formula: C₂₄H₃₀O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 446.496

Ref: TM-TN4554

Methyl pseudolarate B

CAS: 82508-34-7

Formula: C₂₄H₃₀O₈

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 446.496

Ref: BP-SBP00261

Methyl pseudolarate B

CAS: 82508-34-7

Methyl pseudolarate B is a naturally occurring diterpenoid compound, which is isolated from the bark of the plant Pseudolarix amabilis. This compound belongs to a broader class of compounds known for their bioactivity, specifically in the context of traditional Chinese medicine. The mode of action of methyl pseudolarate B involves modulation of cellular pathways that can lead to apoptosis, particularly in cancerous cells. It is thought to interfere with cell cycle progression and induce cell death, thereby exhibiting significant potential as an anticancer agent.

Formula: C₂₄H₃₀O₈

Purity: Min. 95%

Molecular weight: 446.5 g/mol

Ref: 3D-HDA50834