
CAS 82508-35-8
:Demethylpseudolaric acid B
Description:
Demethylpseudolaric acid B is a naturally occurring compound classified as a triterpenoid, specifically derived from the bark of the Pseudolarix amabilis tree. It is known for its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. This compound exhibits a range of pharmacological properties, including anti-inflammatory, anti-tumor, and anti-viral activities, making it of interest in medicinal chemistry and drug development. Demethylpseudolaric acid B has been studied for its potential therapeutic applications, particularly in cancer treatment, due to its ability to induce apoptosis in certain cancer cell lines. Additionally, it may interact with various biological pathways, influencing cell signaling and proliferation. Its solubility characteristics and stability under different conditions are essential for its application in formulations. As with many natural products, further research is necessary to fully understand its mechanisms of action and potential side effects, as well as to explore its efficacy in clinical settings.
Formula:C22H26O8
InChI:InChI=1S/C22H26O8/c1-13(17(24)25)5-4-9-20(3)16-8-11-21(19(28)30-20)10-6-15(18(26)27)7-12-22(16,21)29-14(2)23/h4-6,9,16H,7-8,10-12H2,1-3H3,(H,24,25)(H,26,27)/b9-4+,13-5+/t16-,20+,21+,22-/m0/s1
InChI key:ZPSQWDVEMDWXPJ-HPHAYBORSA-N
SMILES:C/C(=C\C=C\[C@@]1([C@@H]2CC[C@@]3([C@@]2(CCC(=CC3)C(=O)O)OC(=O)C)C(=O)O1)C)/C(=O)O
Synonyms:- Pseudolaric Acid C2
- Demethylpseudolaric acid B
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Pseudolaric Acid C2
CAS:Pseudolaric Acid C2 is a diterpenoid isolated from Pseudolarix kaempferi.Formula:C22H26O8Purity:99.19% - 99.47%Color and Shape:SolidMolecular weight:418.44Pseudolaric acid C2
CAS:Pseudolaric acid C2 is a diterpenoid compound, which is isolated from the root bark of Pseudolarix amabilis, a species of tree native to East Asia. This compound is part of a group of naturally occurring substances known for their bioactive properties. Its mode of action involves disrupting cellular processes in target organisms, thereby exhibiting antifungal, antimicrobial, and antitumor activities. Pseudolaric acid C2 interferes with microtubule polymerization, which impedes cell division and leads to cell cycle arrest in pathogenic fungi and cancer cells.Formula:C22H26O8Purity:Min. 95%Molecular weight:418.4 g/mol






