CAS 82514-58-7

2-Amino-5,6-dihydro-4H-cyclopentathiazole hydrochloride

Description:

2-Amino-5,6-dihydro-4H-cyclopentathiazole hydrochloride is a chemical compound characterized by its unique bicyclic structure, which incorporates both a thiazole and a cyclopentane moiety. This compound features an amino group, contributing to its potential as a building block in medicinal chemistry. The hydrochloride salt form enhances its solubility in water, making it more suitable for biological applications. The presence of sulfur in the thiazole ring imparts distinct chemical reactivity, which can be exploited in various synthetic pathways. Additionally, the compound may exhibit biological activity, potentially serving as a lead compound in drug discovery. Its molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, influencing its pharmacokinetic properties. As with many nitrogen and sulfur-containing heterocycles, it may also display interesting electronic properties, making it a subject of interest in materials science and organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₉ClN₂S

InChI: InChI=1/C6H8N2S.ClH/c7-6-8-4-2-1-3-5(4)9-6;/h1-3H2,(H2,7,8);1H

SMILES: C1Cc2c(C1)sc(=N)[nH]2.Cl

5,6-Dihydro-4H-cyclopenta[d]thiazol-2-amine hydrochloride

CAS: 82514-58-7

Formula: C₆H₉ClN₂S

Molecular weight: 176.6671

Ref: IN-DA00G2G2