CAS 82514-69-0
:2-[(5-Methyl-2-thiazolyl)amino]-2-oxoacetic acid
Description:
2-[(5-Methyl-2-thiazolyl)amino]-2-oxoacetic acid, with the CAS number 82514-69-0, is a chemical compound characterized by its unique structural features, which include a thiazole ring and an amino acid derivative. This compound typically exhibits properties associated with both thiazole and amino acid functionalities, such as potential biological activity and solubility in polar solvents. The presence of the thiazole moiety may contribute to its reactivity and interaction with biological systems, making it of interest in pharmaceutical research. The carboxylic acid group in its structure suggests it can participate in acid-base reactions, while the oxo group may enhance its reactivity in various chemical transformations. Additionally, the methyl group on the thiazole ring can influence its steric and electronic properties, potentially affecting its biological activity. Overall, this compound may serve as a valuable intermediate in organic synthesis or as a lead compound in drug development, particularly in the context of targeting specific biological pathways.
Formula:C6H6N2O3S
InChI:InChI=1S/C6H6N2O3S/c1-3-2-7-6(12-3)8-4(9)5(10)11/h2H,1H3,(H,10,11)(H,7,8,9)
InChI key:InChIKey=YSLGGTIITFTBBY-UHFFFAOYSA-N
SMILES:N(C(C(O)=O)=O)C1=NC=C(C)S1
Synonyms:- Acetic acid, 2-[(5-methyl-2-thiazolyl)amino]-2-oxo-
- 2-[(5-Methyl-2-thiazolyl)amino]-2-oxoacetic acid
- [(5-Methyl-1,3-thiazol-2-yl)carbamoyl]formic acid
- Acetic acid, [(5-methyl-2-thiazolyl)amino]oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-[(5-Methyl-2-thiazolyl)amino]-2-oxoacetic Acid
CAS:Controlled ProductFormula:C6H6N2O3SColor and Shape:NeatMolecular weight:186.188


