CAS 82516-17-4
:1-Piperazineacetic acid, methyl ester
Description:
1-Piperazineacetic acid, methyl ester, with the CAS number 82516-17-4, is an organic compound characterized by its piperazine and acetic acid functional groups. It typically appears as a white to off-white solid or a viscous liquid, depending on its purity and formulation. This compound is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of pharmaceuticals due to the presence of the piperazine moiety, which is often associated with various biological activities. The methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. Additionally, 1-Piperazineacetic acid, methyl ester may exhibit properties such as moderate polarity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H14N2O2
InChI:InChI=1S/C7H14N2O2/c1-11-7(10)6-9-4-2-8-3-5-9/h8H,2-6H2,1H3
InChI key:InChIKey=UHHVABRWHRKEPJ-UHFFFAOYSA-N
SMILES:C(C(OC)=O)N1CCNCC1
Synonyms:- 1-Methyloxycarbonylmethylpiperazine
- 1-Piperazineacetic acid, methyl ester
- Methyl 1-piperazineacetate
- Methyl piperazinoacetate
- Methyl1-piperazineacetate
- Methyl 2-piperazin-1-ylacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
