CAS 82516-57-2
:1-[(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl]piperazine
Description:
1-[(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl]piperazine, identified by its CAS number 82516-57-2, is a chemical compound characterized by its unique structural features. It contains a piperazine ring, which is a six-membered cyclic amine, and a dioxolane moiety, contributing to its potential reactivity and solubility properties. The presence of the dimethyl groups on the dioxolane enhances steric hindrance, which may influence its interactions with other molecules. This compound is likely to exhibit properties typical of piperazine derivatives, such as basicity due to the nitrogen atoms in the piperazine ring. Additionally, the dioxolane structure may impart some degree of polarity, affecting its solubility in various solvents. The compound's potential applications could span pharmaceuticals, where piperazine derivatives are often explored for their biological activity, or in materials science, depending on its specific properties. However, detailed studies would be necessary to fully elucidate its behavior and applications in various chemical contexts.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c1-10(2)13-8-9(14-10)7-12-5-3-11-4-6-12/h9,11H,3-8H2,1-2H3
InChI key:InChIKey=CUTBQYOJWOSAHD-UHFFFAOYSA-N
SMILES:C(C1OC(C)(C)OC1)N2CCNCC2
Synonyms:- Piperazine, 1-[(2,2-Dimethyl-1,3-Dioxolan-4-Yl)Methyl]-
- 1-[(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl]piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl]piperazine
CAS:1-[(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl]piperazine
Molecular weight:200.278g/mol

