CAS 82520-41-0

(3-Chlorophenyl)(4-ethylphenyl)methanone

Description:

(3-Chlorophenyl)(4-ethylphenyl)methanone, with the CAS number 82520-41-0, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to a methanone structure. This compound features a chlorinated phenyl group at the 3-position and an ethyl-substituted phenyl group at the 4-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic rings. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for electrophilic substitution reactions. Additionally, the ethyl group can affect the steric hindrance and electronic properties of the molecule, which may be relevant in various chemical reactions or applications. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₅H₁₃ClO

InChI: InChI=1S/C15H13ClO/c1-2-11-6-8-12(9-7-11)15(17)13-4-3-5-14(16)10-13/h3-10H,2H2,1H3

InChI key: InChIKey=ZCWDNKZZXWHWLW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C2=CC=C(CC)C=C2

Synonyms:

• 3-Chloro-4′-ethylbenzophenone
• Methanone, (3-chlorophenyl)(4-ethylphenyl)-
• (3-Chlorophenyl)(4-ethylphenyl)methanone

3-Chloro-4′-ethylbenzophenone

CAS: 82520-41-0

Formula: C₁₅H₁₃ClO

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 244.72

Ref: 10-F022713