CAS 82523-08-8

rel-(4R,6R)-4,5,6,7-Tetrahydro-4-phenyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid

Description:

Rel-(4R,6R)-4,5,6,7-Tetrahydro-4-phenyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid is a chemical compound characterized by its complex bicyclic structure, which includes an imidazopyridine framework. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a phenyl group that contributes to its aromatic properties. The presence of a carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The stereochemistry, denoted by the (4R,6R) configuration, indicates specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and interactions. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, although specific biological activities would require further investigation. Overall, its unique structural features and functional groups make it a candidate for various applications in chemical research and drug development.

Formula: C₁₃H₁₃N₃O₂

InChI: InChI=1/C13H13N3O2/c17-13(18)10-6-9-12(15-7-14-9)11(16-10)8-4-2-1-3-5-8/h1-5,7,10-11,16H,6H2,(H,14,15)(H,17,18)/t10-,11-/s2

InChI key: InChIKey=KFBHKNNDUHHZKT-DUJBIPCPNA-N

SMILES: C(O)(=O)[C@H]1N[C@H](C2=C(C1)NC=N2)C3=CC=CC=C3

Synonyms:

• 3H-Imidazo[4,5-c]pyridine-6-carboxylic acid, 4,5,6,7-tetrahydro-4-phenyl-, (4R,6R)-rel-
• 1H-Imidazo[4,5-c]pyridine-6-carboxylic acid, 4,5,6,7-tetrahydro-4-phenyl-, cis-
• rel-(4R,6R)-4,5,6,7-Tetrahydro-4-phenyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid