CymitQuimica logo

CAS 82525-64-2

:

methyl 4-[(chloroacetyl)amino]benzoate

Description:
Methyl 4-[(chloroacetyl)amino]benzoate, with the CAS number 82525-64-2, is an organic compound characterized by its ester functional group and the presence of both chloroacetyl and amino substituents on a benzoate structure. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic ring. The chloroacetyl group introduces reactivity, making it a potential intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the amino group can facilitate further chemical modifications, allowing for the introduction of various functional groups. Methyl 4-[(chloroacetyl)amino]benzoate may exhibit biological activity, which can be explored in medicinal chemistry contexts. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity associated with the chloroacetyl moiety.
Formula:C10H10ClNO3
InChI:InChI=1/C10H10ClNO3/c1-15-10(14)7-2-4-8(5-3-7)12-9(13)6-11/h2-5H,6H2,1H3,(H,12,13)
SMILES:COC(=O)c1ccc(cc1)NC(=O)CCl
Synonyms:
  • Benzoic Acid, 4-[(2-Chloroacetyl)Amino]-, Methyl Ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.