
CAS 82543-85-9
:Deoxyhypusine
Description:
Deoxyhypusine, identified by its CAS number 82543-85-9, is a biochemical compound that plays a crucial role in the post-translational modification of proteins, particularly in the activation of eukaryotic translation initiation factor 5A (eIF5A). This modification involves the conversion of lysine residues into hypusine, a process essential for cellular growth and proliferation. Deoxyhypusine is characterized by its unique structure, which includes a polyamine moiety, contributing to its biological activity. It is typically found in various organisms, including humans, where it is synthesized from the amino acid lysine. The compound is of interest in research related to cancer, as eIF5A is implicated in the regulation of cell cycle and apoptosis. Additionally, deoxyhypusine's role in cellular processes makes it a potential target for therapeutic interventions. Its solubility and stability in biological systems are also important characteristics that influence its function and utility in biochemical studies.
Formula:C10H23N3O2
InChI:InChI=1S/C10H23N3O2/c11-6-2-4-8-13-7-3-1-5-9(12)10(14)15/h9,13H,1-8,11-12H2,(H,14,15)/t9-/m0/s1
InChI key:InChIKey=PGPFBXMCOQNMJO-VIFPVBQESA-N
SMILES:C(CCNCCCCN)C[C@@H](C(O)=O)N
Synonyms:- N6-(4-Aminobutyl)-L-lysine
- L-Lysine, N6-(4-aminobutyl)-
- Deoxyhypusine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Deoxyhypusine
CAS:<p>Deoxyhypusine is a enzyme.</p>Formula:C10H23N3O2Color and Shape:SolidMolecular weight:217.31
