CAS 82551-63-1

4-Nitrobenzyl 2-diazoacetoacetate

Description:

4-Nitrobenzyl 2-diazoacetoacetate is a chemical compound characterized by its diazo and ester functional groups, which contribute to its reactivity and utility in organic synthesis. It typically appears as a yellow to orange solid, reflecting the presence of the nitro group, which can influence its electronic properties and reactivity. The compound is known for its ability to undergo photochemical reactions, making it valuable in the field of photochemistry and as a precursor in the synthesis of various organic compounds. Its diazo group is particularly notable for its ability to participate in cycloaddition reactions and other transformations, which are essential in the development of complex molecular architectures. Additionally, the presence of the nitro group can enhance the electrophilicity of the compound, facilitating further reactions. As with many diazo compounds, it should be handled with care due to potential instability and sensitivity to heat and light. Overall, 4-Nitrobenzyl 2-diazoacetoacetate serves as an important intermediate in synthetic organic chemistry.

Formula: C₁₁H₉N₃O₅

InChI: InChI=1/C11H9N3O5/c1-7(15)10(13-12)11(16)19-6-8-2-4-9(5-3-8)14(17)18/h2-5H,6H2,1H3

SMILES: CC(=O)C(=C([O-])OCc1ccc(cc1)N(=O)=O)[N+]#N

Synonyms:

• P-Nitrobenzyl-2-Diazoacetoacetate
• 4-Nitrobenzyl 2-Diazo-3-Oxobutanoate
• M2
• 4-Nitrobenzyl-2-diazoacetoacetate

4-Nitrobenzyl 2-diazoacetoacetate

CAS: 82551-63-1

Formula: C₁₁H₉N₃O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 263.2063

Ref: IN-DA00575W

4-Nitrobenzyl 2-diazo-3-oxobutanoate

CAS: 82551-63-1

4-Nitrobenzyl 2-diazo-3-oxobutanoate

Purity: 98%

Molecular weight: 263.21g/mol

Ref: 54-OR1029083

4-Nitrobenzyl2-diazoacetoacetate

Controlled Product

CAS: 82551-63-1

Applications 4-Nitrobenzyl2-diazoacetoacetate (CAS# 82551-63-1) is a useful research chemical compound.

Formula: C₁₁H₉N₃O₅

Color and Shape: Light Yellow

Molecular weight: 263.206

Ref: TR-N232735