CymitQuimica logo

CAS 82553-75-1

:

2-Methyl-5-nitro-1H-imidazole-1-propanoic acid

Description:
2-Methyl-5-nitro-1H-imidazole-1-propanoic acid, with the CAS number 82553-75-1, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. This substance features a methyl group and a nitro group, contributing to its unique chemical properties and reactivity. The presence of the propanoic acid moiety indicates that it has carboxylic acid functionality, which can participate in various chemical reactions, including esterification and acid-base reactions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's acidity and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, 2-Methyl-5-nitro-1H-imidazole-1-propanoic acid is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C7H9N3O4
InChI:InChI=1S/C7H9N3O4/c1-5-8-4-6(10(13)14)9(5)3-2-7(11)12/h4H,2-3H2,1H3,(H,11,12)
InChI key:InChIKey=UUWFHSWCMMBXDM-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1C(N(=O)=O)=CN=C1C
Synonyms:
  • 1H-Imidazole-1-propanoic acid, 2-methyl-5-nitro-
  • 2-Methyl-5-nitro-1H-imidazole-1-propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.