
CAS 825608-35-3
:α-[(Methylamino)methyl]-1H-indole-1-ethanol
Description:
α-[(Methylamino)methyl]-1H-indole-1-ethanol, identified by its CAS number 825608-35-3, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound contains a hydroxyl group (-OH) and a methylamino group (-NH(CH3)2) attached to the indole, contributing to its potential biological activity. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents and the ability to engage in hydrogen bonding. The compound's structure may allow it to interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, the indole moiety is known for its occurrence in many natural products and its role in neurotransmitter synthesis, which may imply potential applications in neuropharmacology. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through empirical studies.
Formula:C12H16N2O
InChI:InChI=1S/C12H16N2O/c1-13-8-11(15)9-14-7-6-10-4-2-3-5-12(10)14/h2-7,11,13,15H,8-9H2,1H3
InChI key:InChIKey=CYFIXMHPZSFQFE-UHFFFAOYSA-N
SMILES:C(C(CNC)O)N1C=2C(C=C1)=CC=CC2
Synonyms:- 1H-Indole-1-ethanol, α-[(methylamino)methyl]-
- α-[(Methylamino)methyl]-1H-indole-1-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.