CAS 825619-03-2
:4-[(3,4-Dinitrophenyl)methyl]morpholine
Description:
4-[(3,4-Dinitrophenyl)methyl]morpholine, with the CAS number 825619-03-2, is an organic compound characterized by its morpholine structure, which is a six-membered ring containing both nitrogen and oxygen atoms. This compound features a dinitrophenyl group, which is known for its strong electron-withdrawing properties due to the presence of two nitro groups. As a result, 4-[(3,4-Dinitrophenyl)methyl]morpholine may exhibit significant reactivity, particularly in electrophilic aromatic substitution reactions. The morpholine moiety contributes to its potential solubility in polar solvents, while the dinitrophenyl group can enhance its biological activity, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the presence of the dinitro substituents may impart distinct colorimetric properties, allowing for potential applications in analytical chemistry. Safety considerations are important, as compounds containing nitro groups can be hazardous and may require careful handling and storage.
Formula:C11H13N3O5
InChI:InChI=1S/C11H13N3O5/c15-13(16)10-2-1-9(7-11(10)14(17)18)8-12-3-5-19-6-4-12/h1-2,7H,3-6,8H2
InChI key:InChIKey=FHOQFMBDEGJNLR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N(=O)=O)C=CC(CN2CCOCC2)=C1
Synonyms:- 4-(3,4-Dinitrobenzyl)morpholine
- 4-[(3,4-Dinitrophenyl)methyl]morpholine
- Morpholine, 4-[(3,4-dinitrophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.