CAS 825620-20-0

2-phenyl-7-(trifluoromethyl)quinolin-4(1H)-one

Description:

2-Phenyl-7-(trifluoromethyl)quinolin-4(1H)-one is a synthetic organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features a phenyl group at the 2-position and a trifluoromethyl group at the 7-position, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. The carbonyl group at the 4-position indicates that it is a ketone, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit fluorescence and has potential applications in pharmaceuticals, agrochemicals, and materials science. Its specific interactions and reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group and the overall molecular structure, making it a subject of study for its potential therapeutic effects and mechanisms of action.

Formula: C₁₆H₁₀F₃NO

InChI: InChI=1/C16H10F3NO/c17-16(18,19)11-6-7-12-14(8-11)20-13(9-15(12)21)10-4-2-1-3-5-10/h1-9H,(H,20,21)

SMILES: c1ccc(cc1)c1cc(=O)c2ccc(cc2[nH]1)C(F)(F)F

Synonyms:

• 2-Phenyl-7-(trifluoromethyl)quinolin-4-ol
• 4-Quinolinol, 2-Phenyl-7-(Trifluoromethyl)-