CymitQuimica logo

CAS 825620-40-4

:

4-(3,6,9,12,15-Pentaoxahexadec-1-yloxy)benzaldehyde

Description:
4-(3,6,9,12,15-Pentaoxahexadec-1-yloxy)benzaldehyde is a chemical compound characterized by its complex structure, which includes a benzaldehyde moiety and a long-chain ether. The presence of the pentaoxahexadecyl group indicates that it contains five ether linkages within a 16-carbon chain, contributing to its hydrophilic properties while maintaining a hydrophobic aromatic ring. This amphiphilic nature can influence its solubility in various solvents, making it potentially useful in applications such as surfactants or emulsifiers. The aldehyde functional group is reactive, allowing for further chemical modifications or reactions, such as condensation or reduction. Additionally, the compound may exhibit interesting biological activities due to its structural features, which could be explored in medicinal chemistry. Its molecular structure suggests potential applications in materials science, particularly in the development of polymers or coatings that require specific surface properties. Overall, 4-(3,6,9,12,15-Pentaoxahexadec-1-yloxy)benzaldehyde is a versatile compound with unique characteristics stemming from its functional groups and long-chain structure.
Formula:C18H28O7
InChI:InChI=1S/C18H28O7/c1-20-6-7-21-8-9-22-10-11-23-12-13-24-14-15-25-18-4-2-17(16-19)3-5-18/h2-5,16H,6-15H2,1H3
InChI key:InChIKey=VKRAPGZJPMSCTC-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOC)C1=CC=C(C=O)C=C1
Synonyms:
  • Benzaldehyde, 4-(3,6,9,12,15-pentaoxahexadec-1-yloxy)-
  • 4-(3,6,9,12,15-Pentaoxahexadec-1-yloxy)benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.